C26H13Cl2F7N2O3S — CID 86674612
N-[3-[[2,6-dichloro-4-(2,2,2-trifluoro-1-hydroxy-1-thiophen-3-ylethyl)phenyl]carbamoyl]-2-fluorophenyl]-2,4,6-trifluorobenzamide (PubChem CID 86674612) has the molecular formula C26H13Cl2F7N2O3S and a molecular weight of 637.36 g/mol. Its IUPAC name is N-[3-[[2,6-dichloro-4-(2,2,2-trifluoro-1-hydroxy-1-thiophen-3-ylethyl)phenyl]carbamoyl]-2-fluorophenyl]-2,4,6-trifluorobenzamide.
| Compound Name | N-[3-[[2,6-dichloro-4-(2,2,2-trifluoro-1-hydroxy-1-thiophen-3-ylethyl)phenyl]carbamoyl]-2-fluorophenyl]-2,4,6-trifluorobenzamide |
|---|---|
| PubChem CID | 86674612 |
| Molecular Formula | C26H13Cl2F7N2O3S |
| Molecular Weight | 637.36 g/mol |
| Exact Mass | 635.99 |
| IUPAC Name | N-[3-[[2,6-dichloro-4-(2,2,2-trifluoro-1-hydroxy-1-thiophen-3-ylethyl)phenyl]carbamoyl]-2-fluorophenyl]-2,4,6-trifluorobenzamide |
| SMILES | O=C(Nc1c(Cl)cc(C(O)(c2ccsc2)C(F)(F)F)cc1Cl)c1cccc(NC(=O)c2c(F)cc(F)cc2F)c1F |
| InChI | InChI=1S/C26H13Cl2F7N2O3S/c27-15-6-12(25(40,26(33,34)35)11-4-5-41-10-11)7-16(28)22(15)37-23(38)14-2-1-3-19(21(14)32)36-24(39)20-17(30)8-13(29)9-18(20)31/h1-10,40H,(H,36,39)(H,37,38) |
| InChIKey | VWGNLBUZEZUULG-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.36 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |