C17H8F10I2N2O2 — CID 170782750
N-[2,6-diiodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-2-fluoro-3-(hydroxyamino)benzamide (PubChem CID 170782750) has the molecular formula C17H8F10I2N2O2 and a molecular weight of 716.05 g/mol. Its IUPAC name is N-[2,6-diiodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-2-fluoro-3-(hydroxyamino)benzamide.
| Compound Name | N-[2,6-diiodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-2-fluoro-3-(hydroxyamino)benzamide |
|---|---|
| PubChem CID | 170782750 |
| Molecular Formula | C17H8F10I2N2O2 |
| Molecular Weight | 716.05 g/mol |
| Exact Mass | 715.85 |
| IUPAC Name | N-[2,6-diiodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-2-fluoro-3-(hydroxyamino)benzamide |
| SMILES | O=C(Nc1c(I)cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc1I)c1cccc(NO)c1F |
| InChI | InChI=1S/C17H8F10I2N2O2/c18-11-7(2-1-3-10(11)31-33)13(32)30-12-8(28)4-6(5-9(12)29)14(19,16(22,23)24)15(20,21)17(25,26)27/h1-5,31,33H,(H,30,32) |
| InChIKey | DSYHJULWQDSLER-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.05 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|