C19H11F13N2OS — CID 130328582
2-fluoro-3-(methylamino)-N-[4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-2-sulfanyl-6-(trifluoromethyl)phenyl]benzamide (PubChem CID 130328582) has the molecular formula C19H11F13N2OS and a molecular weight of 562.35 g/mol. Its IUPAC name is 2-fluoro-3-(methylamino)-N-[4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-2-sulfanyl-6-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-fluoro-3-(methylamino)-N-[4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-2-sulfanyl-6-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 130328582 |
| Molecular Formula | C19H11F13N2OS |
| Molecular Weight | 562.35 g/mol |
| Exact Mass | 562.04 |
| IUPAC Name | 2-fluoro-3-(methylamino)-N-[4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-2-sulfanyl-6-(trifluoromethyl)phenyl]benzamide |
| SMILES | CNc1cccc(C(=O)Nc2c(S)cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc2C(F)(F)F)c1F |
| InChI | InChI=1S/C19H11F13N2OS/c1-33-10-4-2-3-8(12(10)20)14(35)34-13-9(16(22,23)24)5-7(6-11(13)36)15(21,18(27,28)29)17(25,26)19(30,31)32/h2-6,33,36H,1H3,(H,34,35) |
| InChIKey | WOBWZRXYZCAJIM-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.35 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|