C20H11ClF12N2O3 — CID 163583575
2-chloro-N-[2-ethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]-3-nitrobenzamide (PubChem CID 163583575) has the molecular formula C20H11ClF12N2O3 and a molecular weight of 590.75 g/mol. Its IUPAC name is 2-chloro-N-[2-ethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]-3-nitrobenzamide.
| Compound Name | 2-chloro-N-[2-ethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 163583575 |
| Molecular Formula | C20H11ClF12N2O3 |
| Molecular Weight | 590.75 g/mol |
| Exact Mass | 590.03 |
| IUPAC Name | 2-chloro-N-[2-ethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]-3-nitrobenzamide |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc(C(F)(F)F)c1NC(=O)c1cccc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C20H11ClF12N2O3/c1-2-8-6-9(16(22,19(28,29)30)18(26,27)20(31,32)33)7-11(17(23,24)25)14(8)34-15(36)10-4-3-5-12(13(10)21)35(37)38/h3-7H,2H2,1H3,(H,34,36) |
| InChIKey | GJPUCDSNVGFVAG-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.75 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|