C16H6Br2ClF7N2O3 — CID 87289162
2-chloro-N-[2,6-dibromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-nitrobenzamide (PubChem CID 87289162) has the molecular formula C16H6Br2ClF7N2O3 and a molecular weight of 602.48 g/mol. Its IUPAC name is 2-chloro-N-[2,6-dibromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-nitrobenzamide.
| Compound Name | 2-chloro-N-[2,6-dibromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 87289162 |
| Molecular Formula | C16H6Br2ClF7N2O3 |
| Molecular Weight | 602.48 g/mol |
| Exact Mass | 599.83 |
| IUPAC Name | 2-chloro-N-[2,6-dibromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-3-nitrobenzamide |
| SMILES | O=C(Nc1c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1Br)c1cccc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C16H6Br2ClF7N2O3/c17-8-4-6(14(20,15(21,22)23)16(24,25)26)5-9(18)12(8)27-13(29)7-2-1-3-10(11(7)19)28(30)31/h1-5H,(H,27,29) |
| InChIKey | UPKKSVOEZCYNII-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.48 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|