C18H8F13IN2O — CID 87289016
3-amino-2-fluoro-N-[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]benzamide (PubChem CID 87289016) has the molecular formula C18H8F13IN2O and a molecular weight of 642.15 g/mol. Its IUPAC name is 3-amino-2-fluoro-N-[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-amino-2-fluoro-N-[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 87289016 |
| Molecular Formula | C18H8F13IN2O |
| Molecular Weight | 642.15 g/mol |
| Exact Mass | 641.95 |
| IUPAC Name | 3-amino-2-fluoro-N-[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]benzamide |
| SMILES | Nc1cccc(C(=O)Nc2c(I)cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc2C(F)(F)F)c1F |
| InChI | InChI=1S/C18H8F13IN2O/c19-11-7(2-1-3-10(11)33)13(35)34-12-8(15(21,22)23)4-6(5-9(12)32)14(20,17(26,27)28)16(24,25)18(29,30)31/h1-5H,33H2,(H,34,35) |
| InChIKey | VZNOWBHJDLXCCK-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.15 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|