C19H9F13INO — CID 58297526
1-(3-amino-2-fluorophenyl)-2-[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]ethanone (PubChem CID 58297526) has the molecular formula C19H9F13INO and a molecular weight of 641.16 g/mol. Its IUPAC name is 1-(3-amino-2-fluorophenyl)-2-[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-(3-amino-2-fluorophenyl)-2-[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 58297526 |
| Molecular Formula | C19H9F13INO |
| Molecular Weight | 641.16 g/mol |
| Exact Mass | 640.95 |
| IUPAC Name | 1-(3-amino-2-fluorophenyl)-2-[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]ethanone |
| SMILES | Nc1cccc(C(=O)Cc2c(I)cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc2C(F)(F)F)c1F |
| InChI | InChI=1S/C19H9F13INO/c20-14-8(2-1-3-12(14)34)13(35)6-9-10(16(22,23)24)4-7(5-11(9)33)15(21,18(27,28)29)17(25,26)19(30,31)32/h1-5H,6,34H2 |
| InChIKey | AOXXKJQBXZZXIK-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.16 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|