C25H14F11IN2O2 — CID 87359863
3-(2-carbamoylphenyl)-2-fluoro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-iodo-6-(trifluoromethyl)phenyl]-N-methylbenzamide (PubChem CID 87359863) has the molecular formula C25H14F11IN2O2 and a molecular weight of 710.28 g/mol. Its IUPAC name is 3-(2-carbamoylphenyl)-2-fluoro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-iodo-6-(trifluoromethyl)phenyl]-N-methylbenzamide.
| Compound Name | 3-(2-carbamoylphenyl)-2-fluoro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-iodo-6-(trifluoromethyl)phenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 87359863 |
| Molecular Formula | C25H14F11IN2O2 |
| Molecular Weight | 710.28 g/mol |
| Exact Mass | 709.99 |
| IUPAC Name | 3-(2-carbamoylphenyl)-2-fluoro-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-iodo-6-(trifluoromethyl)phenyl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1cccc(-c2ccccc2C(N)=O)c1F)c1c(I)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C25H14F11IN2O2/c1-39(21(41)15-8-4-7-13(18(15)26)12-5-2-3-6-14(12)20(38)40)19-16(23(28,29)30)9-11(10-17(19)37)22(27,24(31,32)33)25(34,35)36/h2-10H,1H3,(H2,38,40) |
| InChIKey | KNLFNJWCROKCCA-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.28 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|