C26H14F11IN2O4 — CID 138497292
N-[2-fluoro-3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-iodo-6-(trifluoromethyl)phenyl]carbamoyl]phenyl]-N-methyl-1,3-benzodioxole-5-carboxamide (PubChem CID 138497292) has the molecular formula C26H14F11IN2O4 and a molecular weight of 754.29 g/mol. Its IUPAC name is N-[2-fluoro-3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-iodo-6-(trifluoromethyl)phenyl]carbamoyl]phenyl]-N-methyl-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[2-fluoro-3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-iodo-6-(trifluoromethyl)phenyl]carbamoyl]phenyl]-N-methyl-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 138497292 |
| Molecular Formula | C26H14F11IN2O4 |
| Molecular Weight | 754.29 g/mol |
| Exact Mass | 753.98 |
| IUPAC Name | N-[2-fluoro-3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-iodo-6-(trifluoromethyl)phenyl]carbamoyl]phenyl]-N-methyl-1,3-benzodioxole-5-carboxamide |
| SMILES | CN(C(=O)c1ccc2c(c1)OCO2)c1cccc(C(=O)Nc2c(I)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2C(F)(F)F)c1F |
| InChI | InChI=1S/C26H14F11IN2O4/c1-40(22(42)11-5-6-17-18(7-11)44-10-43-17)16-4-2-3-13(19(16)27)21(41)39-20-14(24(29,30)31)8-12(9-15(20)38)23(28,25(32,33)34)26(35,36)37/h2-9H,10H2,1H3,(H,39,41) |
| InChIKey | LMKSSYSEFLREBO-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.29 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|