C27H18F12N2O2 — CID 163687487
2-fluoro-3-[(4-fluorobenzoyl)-methylamino]-N-[4-(1,1,1,2,3,4,4-heptafluorobutan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]benzamide (PubChem CID 163687487) has the molecular formula C27H18F12N2O2 and a molecular weight of 630.43 g/mol. Its IUPAC name is 2-fluoro-3-[(4-fluorobenzoyl)-methylamino]-N-[4-(1,1,1,2,3,4,4-heptafluorobutan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-fluoro-3-[(4-fluorobenzoyl)-methylamino]-N-[4-(1,1,1,2,3,4,4-heptafluorobutan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 163687487 |
| Molecular Formula | C27H18F12N2O2 |
| Molecular Weight | 630.43 g/mol |
| Exact Mass | 630.12 |
| IUPAC Name | 2-fluoro-3-[(4-fluorobenzoyl)-methylamino]-N-[4-(1,1,1,2,3,4,4-heptafluorobutan-2-yl)-2-methyl-6-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1cc(C(F)(C(F)C(F)F)C(F)(F)F)cc(C(F)(F)F)c1NC(=O)c1cccc(N(C)C(=O)c2ccc(F)cc2)c1F |
| InChI | InChI=1S/C27H18F12N2O2/c1-12-10-14(25(33,27(37,38)39)21(30)22(31)32)11-17(26(34,35)36)20(12)40-23(42)16-4-3-5-18(19(16)29)41(2)24(43)13-6-8-15(28)9-7-13/h3-11,21-22H,1-2H3,(H,40,42) |
| InChIKey | JQCGCLIIDVJLSZ-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.43 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |