C26H26FN3O4 — CID 46833898
N-(2,6-dimethyl-4-propan-2-ylphenyl)-3-[(4-fluorobenzoyl)-methylamino]-2-nitrobenzamide (PubChem CID 46833898) has the molecular formula C26H26FN3O4 and a molecular weight of 463.51 g/mol. Its IUPAC name is N-(2,6-dimethyl-4-propan-2-ylphenyl)-3-[(4-fluorobenzoyl)-methylamino]-2-nitrobenzamide.
| Compound Name | N-(2,6-dimethyl-4-propan-2-ylphenyl)-3-[(4-fluorobenzoyl)-methylamino]-2-nitrobenzamide |
|---|---|
| PubChem CID | 46833898 |
| Molecular Formula | C26H26FN3O4 |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | N-(2,6-dimethyl-4-propan-2-ylphenyl)-3-[(4-fluorobenzoyl)-methylamino]-2-nitrobenzamide |
| SMILES | Cc1cc(C(C)C)cc(C)c1NC(=O)c1cccc(N(C)C(=O)c2ccc(F)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C26H26FN3O4/c1-15(2)19-13-16(3)23(17(4)14-19)28-25(31)21-7-6-8-22(24(21)30(33)34)29(5)26(32)18-9-11-20(27)12-10-18/h6-15H,1-5H3,(H,28,31) |
| InChIKey | YBWZJYIFAKEBJG-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|