C27H26F3N3O4 — CID 46833899
N-(2,6-dimethyl-4-propan-2-ylphenyl)-3-[methyl-[2-(trifluoromethyl)benzoyl]amino]-2-nitrobenzamide (PubChem CID 46833899) has the molecular formula C27H26F3N3O4 and a molecular weight of 513.52 g/mol. Its IUPAC name is N-(2,6-dimethyl-4-propan-2-ylphenyl)-3-[methyl-[2-(trifluoromethyl)benzoyl]amino]-2-nitrobenzamide.
| Compound Name | N-(2,6-dimethyl-4-propan-2-ylphenyl)-3-[methyl-[2-(trifluoromethyl)benzoyl]amino]-2-nitrobenzamide |
|---|---|
| PubChem CID | 46833899 |
| Molecular Formula | C27H26F3N3O4 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | N-(2,6-dimethyl-4-propan-2-ylphenyl)-3-[methyl-[2-(trifluoromethyl)benzoyl]amino]-2-nitrobenzamide |
| SMILES | Cc1cc(C(C)C)cc(C)c1NC(=O)c1cccc(N(C)C(=O)c2ccccc2C(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C27H26F3N3O4/c1-15(2)18-13-16(3)23(17(4)14-18)31-25(34)20-10-8-12-22(24(20)33(36)37)32(5)26(35)19-9-6-7-11-21(19)27(28,29)30/h6-15H,1-5H3,(H,31,34) |
| InChIKey | LALUJYKELXHNNZ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|