C17H16F3NO — CID 7899789
2-(trifluoromethyl)-N-(2,4,6-trimethylphenyl)benzamide (PubChem CID 7899789) has the molecular formula C17H16F3NO and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-(trifluoromethyl)-N-(2,4,6-trimethylphenyl)benzamide.
| Compound Name | 2-(trifluoromethyl)-N-(2,4,6-trimethylphenyl)benzamide |
|---|---|
| PubChem CID | 7899789 |
| Molecular Formula | C17H16F3NO |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-(trifluoromethyl)-N-(2,4,6-trimethylphenyl)benzamide |
| SMILES | Cc1cc(C)c(NC(=O)c2ccccc2C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C17H16F3NO/c1-10-8-11(2)15(12(3)9-10)21-16(22)13-6-4-5-7-14(13)17(18,19)20/h4-9H,1-3H3,(H,21,22) |
| InChIKey | BBALIAFPIYLDRI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |