C23H16F6N2O2 — CID 87595402
N-[3-methyl-2-[[4-(trifluoromethyl)benzoyl]amino]phenyl]-2-(trifluoromethyl)benzamide (PubChem CID 87595402) has the molecular formula C23H16F6N2O2 and a molecular weight of 466.38 g/mol. Its IUPAC name is N-[3-methyl-2-[[4-(trifluoromethyl)benzoyl]amino]phenyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[3-methyl-2-[[4-(trifluoromethyl)benzoyl]amino]phenyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 87595402 |
| Molecular Formula | C23H16F6N2O2 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | N-[3-methyl-2-[[4-(trifluoromethyl)benzoyl]amino]phenyl]-2-(trifluoromethyl)benzamide |
| SMILES | Cc1cccc(NC(=O)c2ccccc2C(F)(F)F)c1NC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H16F6N2O2/c1-13-5-4-8-18(30-21(33)16-6-2-3-7-17(16)23(27,28)29)19(13)31-20(32)14-9-11-15(12-10-14)22(24,25)26/h2-12H,1H3,(H,30,33)(H,31,32) |
| InChIKey | KNVHCVGVSBYAPS-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |