C15H13F3N2O — CID 43152274
N-(2-amino-6-methylphenyl)-4-(trifluoromethyl)benzamide (PubChem CID 43152274) has the molecular formula C15H13F3N2O and a molecular weight of 294.28 g/mol. Its IUPAC name is N-(2-amino-6-methylphenyl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-(2-amino-6-methylphenyl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 43152274 |
| Molecular Formula | C15H13F3N2O |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-(2-amino-6-methylphenyl)-4-(trifluoromethyl)benzamide |
| SMILES | Cc1cccc(N)c1NC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H13F3N2O/c1-9-3-2-4-12(19)13(9)20-14(21)10-5-7-11(8-6-10)15(16,17)18/h2-8H,19H2,1H3,(H,20,21) |
| InChIKey | TUAZDBASEFMNSC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|