C16H10F6N2O2 — CID 108933525
N-[2-[(2,2,2-trifluoroacetyl)amino]phenyl]-4-(trifluoromethyl)benzamide (PubChem CID 108933525) has the molecular formula C16H10F6N2O2 and a molecular weight of 376.26 g/mol. Its IUPAC name is N-[2-[(2,2,2-trifluoroacetyl)amino]phenyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[(2,2,2-trifluoroacetyl)amino]phenyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 108933525 |
| Molecular Formula | C16H10F6N2O2 |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | N-[2-[(2,2,2-trifluoroacetyl)amino]phenyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccccc1NC(=O)C(F)(F)F)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H10F6N2O2/c17-15(18,19)10-7-5-9(6-8-10)13(25)23-11-3-1-2-4-12(11)24-14(26)16(20,21)22/h1-8H,(H,23,25)(H,24,26) |
| InChIKey | CCPNYBKNQWBCQS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |