C48H33F9N6O3 — CID 90291612
1-N,3-N,5-N-tris[2-[4-(trifluoromethyl)anilino]phenyl]benzene-1,3,5-tricarboxamide (PubChem CID 90291612) has the molecular formula C48H33F9N6O3 and a molecular weight of 912.81 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris[2-[4-(trifluoromethyl)anilino]phenyl]benzene-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tris[2-[4-(trifluoromethyl)anilino]phenyl]benzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 90291612 |
| Molecular Formula | C48H33F9N6O3 |
| Molecular Weight | 912.81 g/mol |
| Exact Mass | 912.25 |
| IUPAC Name | 1-N,3-N,5-N-tris[2-[4-(trifluoromethyl)anilino]phenyl]benzene-1,3,5-tricarboxamide |
| SMILES | O=C(Nc1ccccc1Nc1ccc(C(F)(F)F)cc1)c1cc(C(=O)Nc2ccccc2Nc2ccc(C(F)(F)F)cc2)cc(C(=O)Nc2ccccc2Nc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C48H33F9N6O3/c49-46(50,51)31-13-19-34(20-14-31)58-37-7-1-4-10-40(37)61-43(64)28-25-29(44(65)62-41-11-5-2-8-38(41)59-35-21-15-32(16-22-35)47(52,53)54)27-30(26-28)45(66)63-42-12-6-3-9-39(42)60-36-23-17-33(18-24-36)48(55,56)57/h1-27,58-60H,(H,61,64)(H,62,65)(H,63,66) |
| InChIKey | SZWQVUVIMGWUFL-UHFFFAOYSA-N |
| XLogP | 13.73 |
| TPSA | 123.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.81 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |