C16H12F3NO3 — CID 16774965
3-methyl-2-[[2-(trifluoromethyl)benzoyl]amino]benzoic acid (PubChem CID 16774965) has the molecular formula C16H12F3NO3 and a molecular weight of 323.27 g/mol. Its IUPAC name is 3-methyl-2-[[2-(trifluoromethyl)benzoyl]amino]benzoic acid.
| Compound Name | 3-methyl-2-[[2-(trifluoromethyl)benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 16774965 |
| Molecular Formula | C16H12F3NO3 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 3-methyl-2-[[2-(trifluoromethyl)benzoyl]amino]benzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1NC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H12F3NO3/c1-9-5-4-7-11(15(22)23)13(9)20-14(21)10-6-2-3-8-12(10)16(17,18)19/h2-8H,1H3,(H,20,21)(H,22,23) |
| InChIKey | CCXLWSRVFVNKNW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |