methyl 2-[(2,4,6-trimethylphenyl)carbamoyl]benzoate

C18H19NO3 — CID 108785438

IUPACmethyl 2-[(2,4,6-trimethylphenyl)carbamoyl]benzoate
SMILESCOC(=O)c1ccccc1C(=O)Nc1c(C)cc(C)cc1C
InChIInChI=1S/C18H19NO3/c1-11-9-12(2)16(13(3)10-11)19-17(20)14-7-5-6-8-15(14)18(21)22-4/h5-10H,1-4H3,(H,19,20)
InChIKeyOHEQULLTQMSZAH-UHFFFAOYSA-N
MW297.35 g/mol
LogP3.65
Rot. Bonds3

About methyl 2-[(2,4,6-trimethylphenyl)carbamoyl]benzoate

methyl 2-[(2,4,6-trimethylphenyl)carbamoyl]benzoate (PubChem CID 108785438) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is methyl 2-[(2,4,6-trimethylphenyl)carbamoyl]benzoate.

Molecular Properties

Compound Namemethyl 2-[(2,4,6-trimethylphenyl)carbamoyl]benzoate
PubChem CID108785438
Molecular FormulaC18H19NO3
Molecular Weight297.35 g/mol
Exact Mass297.14
IUPAC Namemethyl 2-[(2,4,6-trimethylphenyl)carbamoyl]benzoate
SMILESCOC(=O)c1ccccc1C(=O)Nc1c(C)cc(C)cc1C
InChIInChI=1S/C18H19NO3/c1-11-9-12(2)16(13(3)10-11)19-17(20)14-7-5-6-8-15(14)18(21)22-4/h5-10H,1-4H3,(H,19,20)
InChIKeyOHEQULLTQMSZAH-UHFFFAOYSA-N
XLogP3.65
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.35
LogP ≤ 53.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-[(2,4,6-trimethylphenyl)carbamoyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(2,4,6-trimethylphenyl)carbamoyl]benzoate?
The IUPAC name of methyl 2-[(2,4,6-trimethylphenyl)carbamoyl]benzoate (CID 108785438) is methyl 2-[(2,4,6-trimethylphenyl)carbamoyl]benzoate.
What is the SMILES notation for methyl 2-[(2,4,6-trimethylphenyl)carbamoyl]benzoate?
The canonical SMILES for methyl 2-[(2,4,6-trimethylphenyl)carbamoyl]benzoate is COC(=O)c1ccccc1C(=O)Nc1c(C)cc(C)cc1C.
What is the InChIKey of methyl 2-[(2,4,6-trimethylphenyl)carbamoyl]benzoate?
The InChIKey is OHEQULLTQMSZAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3/c1-11-9-12(2)16(13(3)10-11)19-17(20)14-7-5-6-8-15(14)18(21)22-4/h5-10H,1-4H3,(H,19,20).
What are the key properties of methyl 2-[(2,4,6-trimethylphenyl)carbamoyl]benzoate?
methyl 2-[(2,4,6-trimethylphenyl)carbamoyl]benzoate has a molecular weight of 297.35 g/mol, XLogP of 3.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2,4,6-trimethylphenyl)carbamoyl]benzoate is sourced from PubChem (CID 108785438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).