C28H28F3N3O4 — CID 46834741
N-(2-ethyl-6-methyl-4-propan-2-ylphenyl)-3-[methyl-[2-(trifluoromethyl)benzoyl]amino]-2-nitrobenzamide (PubChem CID 46834741) has the molecular formula C28H28F3N3O4 and a molecular weight of 527.54 g/mol. Its IUPAC name is N-(2-ethyl-6-methyl-4-propan-2-ylphenyl)-3-[methyl-[2-(trifluoromethyl)benzoyl]amino]-2-nitrobenzamide.
| Compound Name | N-(2-ethyl-6-methyl-4-propan-2-ylphenyl)-3-[methyl-[2-(trifluoromethyl)benzoyl]amino]-2-nitrobenzamide |
|---|---|
| PubChem CID | 46834741 |
| Molecular Formula | C28H28F3N3O4 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | N-(2-ethyl-6-methyl-4-propan-2-ylphenyl)-3-[methyl-[2-(trifluoromethyl)benzoyl]amino]-2-nitrobenzamide |
| SMILES | CCc1cc(C(C)C)cc(C)c1NC(=O)c1cccc(N(C)C(=O)c2ccccc2C(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C28H28F3N3O4/c1-6-18-15-19(16(2)3)14-17(4)24(18)32-26(35)21-11-9-13-23(25(21)34(37)38)33(5)27(36)20-10-7-8-12-22(20)28(29,30)31/h7-16H,6H2,1-5H3,(H,32,35) |
| InChIKey | OMQYHHZEKBDYDL-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|