C29H20BrF11N2O2 — CID 146368048
N-[2-bromo-4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-methyl-6-(trifluoromethyl)phenyl]-3-[cyclopropylmethyl-(4-fluorobenzoyl)amino]-2-fluorobenzamide (PubChem CID 146368048) has the molecular formula C29H20BrF11N2O2 and a molecular weight of 717.37 g/mol. Its IUPAC name is N-[2-bromo-4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-methyl-6-(trifluoromethyl)phenyl]-3-[cyclopropylmethyl-(4-fluorobenzoyl)amino]-2-fluorobenzamide.
| Compound Name | N-[2-bromo-4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-methyl-6-(trifluoromethyl)phenyl]-3-[cyclopropylmethyl-(4-fluorobenzoyl)amino]-2-fluorobenzamide |
|---|---|
| PubChem CID | 146368048 |
| Molecular Formula | C29H20BrF11N2O2 |
| Molecular Weight | 717.37 g/mol |
| Exact Mass | 716.05 |
| IUPAC Name | N-[2-bromo-4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-3-methyl-6-(trifluoromethyl)phenyl]-3-[cyclopropylmethyl-(4-fluorobenzoyl)amino]-2-fluorobenzamide |
| SMILES | Cc1c(C(C(F)(F)F)C(F)(F)F)cc(C(F)(F)F)c(NC(=O)c2cccc(N(CC3CC3)C(=O)c3ccc(F)cc3)c2F)c1Br |
| InChI | InChI=1S/C29H20BrF11N2O2/c1-13-18(24(28(36,37)38)29(39,40)41)11-19(27(33,34)35)23(21(13)30)42-25(44)17-3-2-4-20(22(17)32)43(12-14-5-6-14)26(45)15-7-9-16(31)10-8-15/h2-4,7-11,14,24H,5-6,12H2,1H3,(H,42,44) |
| InChIKey | PDZSZBXWKIWGOP-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.37 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |