C28H19BrF10N2O2 — CID 163916762
N-[3-[2-[2-bromo-4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]acetyl]-2-fluorophenyl]-N-(cyclopropylmethyl)pyridine-4-carboxamide (PubChem CID 163916762) has the molecular formula C28H19BrF10N2O2 and a molecular weight of 685.36 g/mol. Its IUPAC name is N-[3-[2-[2-bromo-4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]acetyl]-2-fluorophenyl]-N-(cyclopropylmethyl)pyridine-4-carboxamide.
| Compound Name | N-[3-[2-[2-bromo-4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]acetyl]-2-fluorophenyl]-N-(cyclopropylmethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 163916762 |
| Molecular Formula | C28H19BrF10N2O2 |
| Molecular Weight | 685.36 g/mol |
| Exact Mass | 684.05 |
| IUPAC Name | N-[3-[2-[2-bromo-4-(1,1,1,3,3,3-hexafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]acetyl]-2-fluorophenyl]-N-(cyclopropylmethyl)pyridine-4-carboxamide |
| SMILES | O=C(Cc1c(Br)cc(C(C(F)(F)F)C(F)(F)F)cc1C(F)(F)F)c1cccc(N(CC2CC2)C(=O)c2ccncc2)c1F |
| InChI | InChI=1S/C28H19BrF10N2O2/c29-20-11-16(24(27(34,35)36)28(37,38)39)10-19(26(31,32)33)18(20)12-22(42)17-2-1-3-21(23(17)30)41(13-14-4-5-14)25(43)15-6-8-40-9-7-15/h1-3,6-11,14,24H,4-5,12-13H2 |
| InChIKey | BWYKYGOEKCEYTG-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.36 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |