C27H18ClF10N3O3 — CID 166590156
6-chloro-N-(cyclopropylmethyl)-N-[3-[[2-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]carbamoyl]-2-fluorophenyl]pyridine-3-carboxamide (PubChem CID 166590156) has the molecular formula C27H18ClF10N3O3 and a molecular weight of 657.89 g/mol. Its IUPAC name is 6-chloro-N-(cyclopropylmethyl)-N-[3-[[2-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]carbamoyl]-2-fluorophenyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(cyclopropylmethyl)-N-[3-[[2-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]carbamoyl]-2-fluorophenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166590156 |
| Molecular Formula | C27H18ClF10N3O3 |
| Molecular Weight | 657.89 g/mol |
| Exact Mass | 657.09 |
| IUPAC Name | 6-chloro-N-(cyclopropylmethyl)-N-[3-[[2-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]carbamoyl]-2-fluorophenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1OC(F)F)c1cccc(N(CC2CC2)C(=O)c2ccc(Cl)nc2)c1F |
| InChI | InChI=1S/C27H18ClF10N3O3/c28-20-9-6-14(11-39-20)23(43)41(12-13-4-5-13)18-3-1-2-16(21(18)29)22(42)40-17-8-7-15(10-19(17)44-24(30)31)25(32,26(33,34)35)27(36,37)38/h1-3,6-11,13,24H,4-5,12H2,(H,40,42) |
| InChIKey | AWPRIDOBCLJIAP-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.89 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|