C27H18BrF10N3O5 — CID 175592378
ethyl 2-[3-[[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]carbamoyl]-2-fluoro-N-(pyridine-3-carbonyl)anilino]acetate (PubChem CID 175592378) has the molecular formula C27H18BrF10N3O5 and a molecular weight of 734.34 g/mol. Its IUPAC name is ethyl 2-[3-[[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]carbamoyl]-2-fluoro-N-(pyridine-3-carbonyl)anilino]acetate.
| Compound Name | ethyl 2-[3-[[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]carbamoyl]-2-fluoro-N-(pyridine-3-carbonyl)anilino]acetate |
|---|---|
| PubChem CID | 175592378 |
| Molecular Formula | C27H18BrF10N3O5 |
| Molecular Weight | 734.34 g/mol |
| Exact Mass | 733.03 |
| IUPAC Name | ethyl 2-[3-[[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]carbamoyl]-2-fluoro-N-(pyridine-3-carbonyl)anilino]acetate |
| SMILES | CCOC(=O)CN(C(=O)c1cccnc1)c1cccc(C(=O)Nc2c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2OC(F)F)c1F |
| InChI | InChI=1S/C27H18BrF10N3O5/c1-2-45-19(42)12-41(23(44)13-5-4-8-39-11-13)17-7-3-6-15(20(17)29)22(43)40-21-16(28)9-14(10-18(21)46-24(30)31)25(32,26(33,34)35)27(36,37)38/h3-11,24H,2,12H2,1H3,(H,40,43) |
| InChIKey | YQZZMVLGCXBFAJ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.34 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |