C23H11BrF11N3O3 — CID 175525419
N-[3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-N-hydroxypyridine-3-carboxamide (PubChem CID 175525419) has the molecular formula C23H11BrF11N3O3 and a molecular weight of 666.24 g/mol. Its IUPAC name is N-[3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-N-hydroxypyridine-3-carboxamide.
| Compound Name | N-[3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-N-hydroxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 175525419 |
| Molecular Formula | C23H11BrF11N3O3 |
| Molecular Weight | 666.24 g/mol |
| Exact Mass | 664.98 |
| IUPAC Name | N-[3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-N-hydroxypyridine-3-carboxamide |
| SMILES | O=C(Nc1c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc1C(F)(F)F)c1cccc(N(O)C(=O)c2cccnc2)c1F |
| InChI | InChI=1S/C23H11BrF11N3O3/c24-14-8-11(20(26,22(30,31)32)23(33,34)35)7-13(21(27,28)29)17(14)37-18(39)12-4-1-5-15(16(12)25)38(41)19(40)10-3-2-6-36-9-10/h1-9,41H,(H,37,39) |
| InChIKey | NZKMVGLGRUGDDE-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.24 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|