C25H10BrF13N2O4 — CID 146573644
N-[3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-2,2-difluoro-1,3-benzodioxole-5-carboxamide (PubChem CID 146573644) has the molecular formula C25H10BrF13N2O4 and a molecular weight of 729.24 g/mol. Its IUPAC name is N-[3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-2,2-difluoro-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-2,2-difluoro-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 146573644 |
| Molecular Formula | C25H10BrF13N2O4 |
| Molecular Weight | 729.24 g/mol |
| Exact Mass | 727.96 |
| IUPAC Name | N-[3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-2,2-difluoro-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1cccc(C(=O)Nc2c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2C(F)(F)F)c1F)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C25H10BrF13N2O4/c26-13-8-10(21(28,23(32,33)34)24(35,36)37)7-12(22(29,30)31)18(13)41-20(43)11-2-1-3-14(17(11)27)40-19(42)9-4-5-15-16(6-9)45-25(38,39)44-15/h1-8H,(H,40,42)(H,41,43) |
| InChIKey | SXVFGGOQCGXPAZ-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.24 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |