C17H8BrF11N2OS — CID 170782745
N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]-2-fluoro-3-(hydroxyamino)benzenecarbothioamide (PubChem CID 170782745) has the molecular formula C17H8BrF11N2OS and a molecular weight of 577.21 g/mol. Its IUPAC name is N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]-2-fluoro-3-(hydroxyamino)benzenecarbothioamide.
| Compound Name | N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]-2-fluoro-3-(hydroxyamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 170782745 |
| Molecular Formula | C17H8BrF11N2OS |
| Molecular Weight | 577.21 g/mol |
| Exact Mass | 575.94 |
| IUPAC Name | N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]-2-fluoro-3-(hydroxyamino)benzenecarbothioamide |
| SMILES | ONc1cccc(C(=S)Nc2c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2C(F)(F)F)c1F |
| InChI | InChI=1S/C17H8BrF11N2OS/c18-9-5-6(14(20,16(24,25)26)17(27,28)29)4-8(15(21,22)23)12(9)30-13(33)7-2-1-3-10(31-32)11(7)19/h1-5,31-32H,(H,30,33) |
| InChIKey | VIHNNJRXDPNQNJ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.21 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|