C22H12BrF14N3O3 — CID 118358028
N-[3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-N'-methyl-N'-(2,2,2-trifluoroethyl)oxamide (PubChem CID 118358028) has the molecular formula C22H12BrF14N3O3 and a molecular weight of 712.23 g/mol. Its IUPAC name is N-[3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-N'-methyl-N'-(2,2,2-trifluoroethyl)oxamide.
| Compound Name | N-[3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-N'-methyl-N'-(2,2,2-trifluoroethyl)oxamide |
|---|---|
| PubChem CID | 118358028 |
| Molecular Formula | C22H12BrF14N3O3 |
| Molecular Weight | 712.23 g/mol |
| Exact Mass | 710.98 |
| IUPAC Name | N-[3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluorophenyl]-N'-methyl-N'-(2,2,2-trifluoroethyl)oxamide |
| SMILES | CN(CC(F)(F)F)C(=O)C(=O)Nc1cccc(C(=O)Nc2c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2C(F)(F)F)c1F |
| InChI | InChI=1S/C22H12BrF14N3O3/c1-40(7-18(25,26)27)17(43)16(42)38-12-4-2-3-9(13(12)24)15(41)39-14-10(20(29,30)31)5-8(6-11(14)23)19(28,21(32,33)34)22(35,36)37/h2-6H,7H2,1H3,(H,38,42)(H,39,41) |
| InChIKey | QEWIBKCGHZPJFX-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.23 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|