C30H15BrF11N3O4 — CID 176548883
[N-benzoyl-3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluoroanilino] pyridine-3-carboxylate (PubChem CID 176548883) has the molecular formula C30H15BrF11N3O4 and a molecular weight of 770.35 g/mol. Its IUPAC name is [N-benzoyl-3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluoroanilino] pyridine-3-carboxylate.
| Compound Name | [N-benzoyl-3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluoroanilino] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 176548883 |
| Molecular Formula | C30H15BrF11N3O4 |
| Molecular Weight | 770.35 g/mol |
| Exact Mass | 769.01 |
| IUPAC Name | [N-benzoyl-3-[[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]carbamoyl]-2-fluoroanilino] pyridine-3-carboxylate |
| SMILES | O=C(ON(C(=O)c1ccccc1)c1cccc(C(=O)Nc2c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2C(F)(F)F)c1F)c1cccnc1 |
| InChI | InChI=1S/C30H15BrF11N3O4/c31-20-13-17(27(33,29(37,38)39)30(40,41)42)12-19(28(34,35)36)23(20)44-24(46)18-9-4-10-21(22(18)32)45(25(47)15-6-2-1-3-7-15)49-26(48)16-8-5-11-43-14-16/h1-14H,(H,44,46) |
| InChIKey | SFFASSZFKSWGJY-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.35 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|