C28H15BrF11IN2O4 — CID 176548908
[3-[[2-bromo-6-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]carbamoyl]-2-fluoro-N-(4-fluorobenzoyl)anilino] cyclopropanecarboxylate (PubChem CID 176548908) has the molecular formula C28H15BrF11IN2O4 and a molecular weight of 859.22 g/mol. Its IUPAC name is [3-[[2-bromo-6-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]carbamoyl]-2-fluoro-N-(4-fluorobenzoyl)anilino] cyclopropanecarboxylate.
| Compound Name | [3-[[2-bromo-6-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]carbamoyl]-2-fluoro-N-(4-fluorobenzoyl)anilino] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 176548908 |
| Molecular Formula | C28H15BrF11IN2O4 |
| Molecular Weight | 859.22 g/mol |
| Exact Mass | 857.91 |
| IUPAC Name | [3-[[2-bromo-6-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]carbamoyl]-2-fluoro-N-(4-fluorobenzoyl)anilino] cyclopropanecarboxylate |
| SMILES | O=C(Nc1c(Br)cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc1I)c1cccc(N(OC(=O)C2CC2)C(=O)c2ccc(F)cc2)c1F |
| InChI | InChI=1S/C28H15BrF11IN2O4/c29-17-10-14(25(32,27(35,36)37)26(33,34)28(38,39)40)11-18(41)21(17)42-22(44)16-2-1-3-19(20(16)31)43(47-24(46)13-4-5-13)23(45)12-6-8-15(30)9-7-12/h1-3,6-11,13H,4-5H2,(H,42,44) |
| InChIKey | LMTGGUQMCDXFHJ-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.22 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|