C18H6BrF13N2O2 — CID 130328437
N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-fluoro-3-nitrosobenzamide (PubChem CID 130328437) has the molecular formula C18H6BrF13N2O2 and a molecular weight of 609.14 g/mol. Its IUPAC name is N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-fluoro-3-nitrosobenzamide.
| Compound Name | N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-fluoro-3-nitrosobenzamide |
|---|---|
| PubChem CID | 130328437 |
| Molecular Formula | C18H6BrF13N2O2 |
| Molecular Weight | 609.14 g/mol |
| Exact Mass | 607.94 |
| IUPAC Name | N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-fluoro-3-nitrosobenzamide |
| SMILES | O=Nc1cccc(C(=O)Nc2c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2C(F)(F)C(F)(F)F)c1F |
| InChI | InChI=1S/C18H6BrF13N2O2/c19-9-5-6(14(21,16(24,25)26)17(27,28)29)4-8(15(22,23)18(30,31)32)12(9)33-13(35)7-2-1-3-10(34-36)11(7)20/h1-5H,(H,33,35) |
| InChIKey | JKQUJMBZFIYNQN-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.14 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|