C20H17F7N2O2 — CID 89216560
N-[2-ethyl-4-(1,1,1,2,3,4-hexafluorobutan-2-yl)-6-methylphenyl]-2-fluoro-3-nitrosobenzamide (PubChem CID 89216560) has the molecular formula C20H17F7N2O2 and a molecular weight of 450.35 g/mol. Its IUPAC name is N-[2-ethyl-4-(1,1,1,2,3,4-hexafluorobutan-2-yl)-6-methylphenyl]-2-fluoro-3-nitrosobenzamide.
| Compound Name | N-[2-ethyl-4-(1,1,1,2,3,4-hexafluorobutan-2-yl)-6-methylphenyl]-2-fluoro-3-nitrosobenzamide |
|---|---|
| PubChem CID | 89216560 |
| Molecular Formula | C20H17F7N2O2 |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | N-[2-ethyl-4-(1,1,1,2,3,4-hexafluorobutan-2-yl)-6-methylphenyl]-2-fluoro-3-nitrosobenzamide |
| SMILES | CCc1cc(C(F)(C(F)CF)C(F)(F)F)cc(C)c1NC(=O)c1cccc(N=O)c1F |
| InChI | InChI=1S/C20H17F7N2O2/c1-3-11-8-12(19(24,15(22)9-21)20(25,26)27)7-10(2)17(11)28-18(30)13-5-4-6-14(29-31)16(13)23/h4-8,15H,3,9H2,1-2H3,(H,28,30) |
| InChIKey | FXOCDIQJXHVRHK-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |