C22H19F7N2O2 — CID 123637666
N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-1-nitroso-2,3-dihydro-1H-indene-5-carboxamide (PubChem CID 123637666) has the molecular formula C22H19F7N2O2 and a molecular weight of 476.39 g/mol. Its IUPAC name is N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-1-nitroso-2,3-dihydro-1H-indene-5-carboxamide.
| Compound Name | N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-1-nitroso-2,3-dihydro-1H-indene-5-carboxamide |
|---|---|
| PubChem CID | 123637666 |
| Molecular Formula | C22H19F7N2O2 |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]-1-nitroso-2,3-dihydro-1H-indene-5-carboxamide |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1ccc2c(c1)CCC2N=O |
| InChI | InChI=1S/C22H19F7N2O2/c1-3-12-10-15(20(23,21(24,25)26)22(27,28)29)8-11(2)18(12)30-19(32)14-4-6-16-13(9-14)5-7-17(16)31-33/h4,6,8-10,17H,3,5,7H2,1-2H3,(H,30,32) |
| InChIKey | RYPNBKFZILDXIZ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |