C26H18ClF10N3O2 — CID 42641000
3-chloro-N-[3-[[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]carbamoyl]phenyl]-6-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 42641000) has the molecular formula C26H18ClF10N3O2 and a molecular weight of 629.88 g/mol. Its IUPAC name is 3-chloro-N-[3-[[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]carbamoyl]phenyl]-6-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | 3-chloro-N-[3-[[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]carbamoyl]phenyl]-6-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 42641000 |
| Molecular Formula | C26H18ClF10N3O2 |
| Molecular Weight | 629.88 g/mol |
| Exact Mass | 629.09 |
| IUPAC Name | 3-chloro-N-[3-[[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]carbamoyl]phenyl]-6-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1cccc(NC(=O)c2nc(C(F)(F)F)ccc2Cl)c1 |
| InChI | InChI=1S/C26H18ClF10N3O2/c1-3-13-10-15(23(28,25(32,33)34)26(35,36)37)9-12(2)19(13)40-21(41)14-5-4-6-16(11-14)38-22(42)20-17(27)7-8-18(39-20)24(29,30)31/h4-11H,3H2,1-2H3,(H,38,42)(H,40,41) |
| InChIKey | ZVOLPIPIVBTYQT-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.88 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |