C22H16ClF7N2O — CID 89106196
2-chloro-N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]quinoline-6-carboxamide (PubChem CID 89106196) has the molecular formula C22H16ClF7N2O and a molecular weight of 492.82 g/mol. Its IUPAC name is 2-chloro-N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]quinoline-6-carboxamide.
| Compound Name | 2-chloro-N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 89106196 |
| Molecular Formula | C22H16ClF7N2O |
| Molecular Weight | 492.82 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | 2-chloro-N-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]quinoline-6-carboxamide |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1ccc2nc(Cl)ccc2c1 |
| InChI | InChI=1S/C22H16ClF7N2O/c1-3-12-10-15(20(24,21(25,26)27)22(28,29)30)8-11(2)18(12)32-19(33)14-4-6-16-13(9-14)5-7-17(23)31-16/h4-10H,3H2,1-2H3,(H,32,33) |
| InChIKey | ADALTFDHUFUIBT-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.82 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|