C29H20ClF9N2O3 — CID 88531281
3-chloro-4-[(1,3-dioxoisoindol-2-yl)methyl]-N-[2-ethyl-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]benzamide (PubChem CID 88531281) has the molecular formula C29H20ClF9N2O3 and a molecular weight of 650.93 g/mol. Its IUPAC name is 3-chloro-4-[(1,3-dioxoisoindol-2-yl)methyl]-N-[2-ethyl-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]benzamide.
| Compound Name | 3-chloro-4-[(1,3-dioxoisoindol-2-yl)methyl]-N-[2-ethyl-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 88531281 |
| Molecular Formula | C29H20ClF9N2O3 |
| Molecular Weight | 650.93 g/mol |
| Exact Mass | 650.10 |
| IUPAC Name | 3-chloro-4-[(1,3-dioxoisoindol-2-yl)methyl]-N-[2-ethyl-6-methyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]benzamide |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc(C)c1NC(=O)c1ccc(CN2C(=O)c3ccccc3C2=O)c(Cl)c1 |
| InChI | InChI=1S/C29H20ClF9N2O3/c1-3-15-11-18(26(31,28(34,35)36)27(32,33)29(37,38)39)10-14(2)22(15)40-23(42)16-8-9-17(21(30)12-16)13-41-24(43)19-6-4-5-7-20(19)25(41)44/h4-12H,3,13H2,1-2H3,(H,40,42) |
| InChIKey | HWZRMUYBYKWCHX-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.93 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|