C20H13BrF9N3O — CID 59226974
3-amino-N-[2-bromo-6-ethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-4-cyanobenzamide (PubChem CID 59226974) has the molecular formula C20H13BrF9N3O and a molecular weight of 562.23 g/mol. Its IUPAC name is 3-amino-N-[2-bromo-6-ethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-4-cyanobenzamide.
| Compound Name | 3-amino-N-[2-bromo-6-ethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-4-cyanobenzamide |
|---|---|
| PubChem CID | 59226974 |
| Molecular Formula | C20H13BrF9N3O |
| Molecular Weight | 562.23 g/mol |
| Exact Mass | 561.01 |
| IUPAC Name | 3-amino-N-[2-bromo-6-ethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-4-cyanobenzamide |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc(Br)c1NC(=O)c1ccc(C#N)c(N)c1 |
| InChI | InChI=1S/C20H13BrF9N3O/c1-2-9-5-12(17(22,19(25,26)27)18(23,24)20(28,29)30)7-13(21)15(9)33-16(34)10-3-4-11(8-31)14(32)6-10/h3-7H,2,32H2,1H3,(H,33,34) |
| InChIKey | NSIVVTGQNPVPMC-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.23 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|