C20H12BrF9N2O — CID 87089029
2-[2-bromo-6-ethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-4-cyanobenzamide (PubChem CID 87089029) has the molecular formula C20H12BrF9N2O and a molecular weight of 547.22 g/mol. Its IUPAC name is 2-[2-bromo-6-ethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-4-cyanobenzamide.
| Compound Name | 2-[2-bromo-6-ethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-4-cyanobenzamide |
|---|---|
| PubChem CID | 87089029 |
| Molecular Formula | C20H12BrF9N2O |
| Molecular Weight | 547.22 g/mol |
| Exact Mass | 546.00 |
| IUPAC Name | 2-[2-bromo-6-ethyl-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-4-cyanobenzamide |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc(Br)c1-c1cc(C#N)ccc1C(N)=O |
| InChI | InChI=1S/C20H12BrF9N2O/c1-2-10-6-11(17(22,19(25,26)27)18(23,24)20(28,29)30)7-14(21)15(10)13-5-9(8-31)3-4-12(13)16(32)33/h3-7H,2H2,1H3,(H2,32,33) |
| InChIKey | MQOURHAXQVKVEP-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 66.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.22 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|