C11H4BrF7N2O — CID 15402157
N-(2-bromo-4-cyanophenyl)-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 15402157) has the molecular formula C11H4BrF7N2O and a molecular weight of 393.06 g/mol. Its IUPAC name is N-(2-bromo-4-cyanophenyl)-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-(2-bromo-4-cyanophenyl)-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 15402157 |
| Molecular Formula | C11H4BrF7N2O |
| Molecular Weight | 393.06 g/mol |
| Exact Mass | 391.94 |
| IUPAC Name | N-(2-bromo-4-cyanophenyl)-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | N#Cc1ccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H4BrF7N2O/c12-6-3-5(4-20)1-2-7(6)21-8(22)9(13,14)10(15,16)11(17,18)19/h1-3H,(H,21,22) |
| InChIKey | SVIMEVADRBXGCU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.06 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|