C10H6BrF7N2O3 — CID 163141219
3-bromo-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-N-hydroxybenzeneamine oxide (PubChem CID 163141219) has the molecular formula C10H6BrF7N2O3 and a molecular weight of 415.06 g/mol. Its IUPAC name is 3-bromo-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-N-hydroxybenzeneamine oxide.
| Compound Name | 3-bromo-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163141219 |
| Molecular Formula | C10H6BrF7N2O3 |
| Molecular Weight | 415.06 g/mol |
| Exact Mass | 413.95 |
| IUPAC Name | 3-bromo-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-N-hydroxybenzeneamine oxide |
| SMILES | O=C(Nc1ccc([NH+]([O-])O)cc1Br)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6BrF7N2O3/c11-5-3-4(20(22)23)1-2-6(5)19-7(21)8(12,13)9(14,15)10(16,17)18/h1-3,20,22H,(H,19,21) |
| InChIKey | JVOBPBUKJKEFTP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.06 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|