C16H8BrF16NO — CID 4250106
N-(2-bromo-4-methylphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide (PubChem CID 4250106) has the molecular formula C16H8BrF16NO and a molecular weight of 614.12 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide |
|---|---|
| PubChem CID | 4250106 |
| Molecular Formula | C16H8BrF16NO |
| Molecular Weight | 614.12 g/mol |
| Exact Mass | 612.95 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide |
| SMILES | Cc1ccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)c(Br)c1 |
| InChI | InChI=1S/C16H8BrF16NO/c1-5-2-3-7(6(17)4-5)34-9(35)11(22,23)13(26,27)15(30,31)16(32,33)14(28,29)12(24,25)10(20,21)8(18)19/h2-4,8H,1H3,(H,34,35) |
| InChIKey | XVDKVRYTPRVDSS-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.12 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|