C13H9F6NO5 — CID 4169297
2-[(4-carboxy-2,2,3,3,4,4-hexafluorobutanoyl)amino]-5-methylbenzoic acid (PubChem CID 4169297) has the molecular formula C13H9F6NO5 and a molecular weight of 373.21 g/mol. Its IUPAC name is 2-[(4-carboxy-2,2,3,3,4,4-hexafluorobutanoyl)amino]-5-methylbenzoic acid.
| Compound Name | 2-[(4-carboxy-2,2,3,3,4,4-hexafluorobutanoyl)amino]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 4169297 |
| Molecular Formula | C13H9F6NO5 |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 2-[(4-carboxy-2,2,3,3,4,4-hexafluorobutanoyl)amino]-5-methylbenzoic acid |
| SMILES | Cc1ccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H9F6NO5/c1-5-2-3-7(6(4-5)8(21)22)20-9(23)11(14,15)13(18,19)12(16,17)10(24)25/h2-4H,1H3,(H,20,23)(H,21,22)(H,24,25) |
| InChIKey | ROMSXJODOUHHIB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|