C18H13F16NO — CID 5220192
N-(2-ethyl-6-methylphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide (PubChem CID 5220192) has the molecular formula C18H13F16NO and a molecular weight of 563.28 g/mol. Its IUPAC name is N-(2-ethyl-6-methylphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide.
| Compound Name | N-(2-ethyl-6-methylphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide |
|---|---|
| PubChem CID | 5220192 |
| Molecular Formula | C18H13F16NO |
| Molecular Weight | 563.28 g/mol |
| Exact Mass | 563.07 |
| IUPAC Name | N-(2-ethyl-6-methylphenyl)-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononanamide |
| SMILES | CCc1cccc(C)c1NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C18H13F16NO/c1-3-8-6-4-5-7(2)9(8)35-11(36)13(23,24)15(27,28)17(31,32)18(33,34)16(29,30)14(25,26)12(21,22)10(19)20/h4-6,10H,3H2,1-2H3,(H,35,36) |
| InChIKey | JNHWYQOLMBCFRA-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.28 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|