C14H19NO3 — CID 82814205
3-(2-ethyl-6-methylanilino)-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 82814205) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 3-(2-ethyl-6-methylanilino)-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-(2-ethyl-6-methylanilino)-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 82814205 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 3-(2-ethyl-6-methylanilino)-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CCc1cccc(C)c1NC(=O)C(C)(C)C(=O)O |
| InChI | InChI=1S/C14H19NO3/c1-5-10-8-6-7-9(2)11(10)15-12(16)14(3,4)13(17)18/h6-8H,5H2,1-4H3,(H,15,16)(H,17,18) |
| InChIKey | VDKYUSBLNDMBBA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|