C20H29NO3 — CID 119107584
3-cyclohexyl-4-(2-ethyl-6-methylanilino)-3-methyl-4-oxobutanoic acid (PubChem CID 119107584) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-cyclohexyl-4-(2-ethyl-6-methylanilino)-3-methyl-4-oxobutanoic acid.
| Compound Name | 3-cyclohexyl-4-(2-ethyl-6-methylanilino)-3-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 119107584 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 3-cyclohexyl-4-(2-ethyl-6-methylanilino)-3-methyl-4-oxobutanoic acid |
| SMILES | CCc1cccc(C)c1NC(=O)C(C)(CC(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C20H29NO3/c1-4-15-10-8-9-14(2)18(15)21-19(24)20(3,13-17(22)23)16-11-6-5-7-12-16/h8-10,16H,4-7,11-13H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | WBOPGWHWQNLLSH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |