C21H28N2O4 — CID 119107600
3-cyclohexyl-4-[4-(cyclopropanecarbonylamino)anilino]-3-methyl-4-oxobutanoic acid (PubChem CID 119107600) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 3-cyclohexyl-4-[4-(cyclopropanecarbonylamino)anilino]-3-methyl-4-oxobutanoic acid.
| Compound Name | 3-cyclohexyl-4-[4-(cyclopropanecarbonylamino)anilino]-3-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 119107600 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 3-cyclohexyl-4-[4-(cyclopropanecarbonylamino)anilino]-3-methyl-4-oxobutanoic acid |
| SMILES | CC(CC(=O)O)(C(=O)Nc1ccc(NC(=O)C2CC2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C21H28N2O4/c1-21(13-18(24)25,15-5-3-2-4-6-15)20(27)23-17-11-9-16(10-12-17)22-19(26)14-7-8-14/h9-12,14-15H,2-8,13H2,1H3,(H,22,26)(H,23,27)(H,24,25) |
| InChIKey | WWGNICAMXNQCCW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |