C19H25FN2O4 — CID 99773752
(3S)-4-(5-acetamido-2-fluoroanilino)-3-cyclohexyl-3-methyl-4-oxobutanoic acid (PubChem CID 99773752) has the molecular formula C19H25FN2O4 and a molecular weight of 364.42 g/mol. Its IUPAC name is (3S)-4-(5-acetamido-2-fluoroanilino)-3-cyclohexyl-3-methyl-4-oxobutanoic acid.
| Compound Name | (3S)-4-(5-acetamido-2-fluoroanilino)-3-cyclohexyl-3-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 99773752 |
| Molecular Formula | C19H25FN2O4 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (3S)-4-(5-acetamido-2-fluoroanilino)-3-cyclohexyl-3-methyl-4-oxobutanoic acid |
| SMILES | CC(=O)Nc1ccc(F)c(NC(=O)[C@@](C)(CC(=O)O)C2CCCCC2)c1 |
| InChI | InChI=1S/C19H25FN2O4/c1-12(23)21-14-8-9-15(20)16(10-14)22-18(26)19(2,11-17(24)25)13-6-4-3-5-7-13/h8-10,13H,3-7,11H2,1-2H3,(H,21,23)(H,22,26)(H,24,25)/t19-/m0/s1 |
| InChIKey | PYAIRVFUCFYMDD-IBGZPJMESA-N |
| XLogP | 3.78 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |