C18H24N2O5 — CID 119107589
3-cyclohexyl-3-methyl-4-(2-methyl-4-nitroanilino)-4-oxobutanoic acid (PubChem CID 119107589) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 3-cyclohexyl-3-methyl-4-(2-methyl-4-nitroanilino)-4-oxobutanoic acid.
| Compound Name | 3-cyclohexyl-3-methyl-4-(2-methyl-4-nitroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 119107589 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 3-cyclohexyl-3-methyl-4-(2-methyl-4-nitroanilino)-4-oxobutanoic acid |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)C(C)(CC(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C18H24N2O5/c1-12-10-14(20(24)25)8-9-15(12)19-17(23)18(2,11-16(21)22)13-6-4-3-5-7-13/h8-10,13H,3-7,11H2,1-2H3,(H,19,23)(H,21,22) |
| InChIKey | YAJAUMOUHPLTBW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|