C22H32N2O4 — CID 119126026
3-cyclohexyl-3-methyl-4-[3-methyl-4-(propan-2-ylcarbamoyl)anilino]-4-oxobutanoic acid (PubChem CID 119126026) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is 3-cyclohexyl-3-methyl-4-[3-methyl-4-(propan-2-ylcarbamoyl)anilino]-4-oxobutanoic acid.
| Compound Name | 3-cyclohexyl-3-methyl-4-[3-methyl-4-(propan-2-ylcarbamoyl)anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 119126026 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 3-cyclohexyl-3-methyl-4-[3-methyl-4-(propan-2-ylcarbamoyl)anilino]-4-oxobutanoic acid |
| SMILES | Cc1cc(NC(=O)C(C)(CC(=O)O)C2CCCCC2)ccc1C(=O)NC(C)C |
| InChI | InChI=1S/C22H32N2O4/c1-14(2)23-20(27)18-11-10-17(12-15(18)3)24-21(28)22(4,13-19(25)26)16-8-6-5-7-9-16/h10-12,14,16H,5-9,13H2,1-4H3,(H,23,27)(H,24,28)(H,25,26) |
| InChIKey | VPAROTUDZMCKGA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |