C21H28N2O4 — CID 119107635
3-cyclohexyl-3-methyl-4-oxo-4-[4-(prop-2-enylcarbamoyl)anilino]butanoic acid (PubChem CID 119107635) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 3-cyclohexyl-3-methyl-4-oxo-4-[4-(prop-2-enylcarbamoyl)anilino]butanoic acid.
| Compound Name | 3-cyclohexyl-3-methyl-4-oxo-4-[4-(prop-2-enylcarbamoyl)anilino]butanoic acid |
|---|---|
| PubChem CID | 119107635 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 3-cyclohexyl-3-methyl-4-oxo-4-[4-(prop-2-enylcarbamoyl)anilino]butanoic acid |
| SMILES | C=CCNC(=O)c1ccc(NC(=O)C(C)(CC(=O)O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H28N2O4/c1-3-13-22-19(26)15-9-11-17(12-10-15)23-20(27)21(2,14-18(24)25)16-7-5-4-6-8-16/h3,9-12,16H,1,4-8,13-14H2,2H3,(H,22,26)(H,23,27)(H,24,25) |
| InChIKey | GFUDCVCFAFJERQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|